C18H17Cl2N5O2S — CID 4770334
4-[[[3-[(3,4-dichlorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-yl]hydrazinylidene]methyl]-2-ethoxyphenol (PubChem CID 4770334) has the molecular formula C18H17Cl2N5O2S and a molecular weight of 438.34 g/mol. Its IUPAC name is 4-[[[3-[(3,4-dichlorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-yl]hydrazinylidene]methyl]-2-ethoxyphenol.
| Compound Name | 4-[[[3-[(3,4-dichlorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-yl]hydrazinylidene]methyl]-2-ethoxyphenol |
|---|---|
| PubChem CID | 4770334 |
| Molecular Formula | C18H17Cl2N5O2S |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 4-[[[3-[(3,4-dichlorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-yl]hydrazinylidene]methyl]-2-ethoxyphenol |
| SMILES | CCOc1cc(C=NNc2nc(SCc3ccc(Cl)c(Cl)c3)n[nH]2)ccc1O |
| InChI | InChI=1S/C18H17Cl2N5O2S/c1-2-27-16-8-11(4-6-15(16)26)9-21-23-17-22-18(25-24-17)28-10-12-3-5-13(19)14(20)7-12/h3-9,26H,2,10H2,1H3,(H2,22,23,24,25) |
| InChIKey | VLWSDIIINTYVDS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|