C20H22Cl2N6S — CID 6210254
3-[(3,4-dichlorophenyl)methylsulfanyl]-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-1H-1,2,4-triazol-5-amine (PubChem CID 6210254) has the molecular formula C20H22Cl2N6S and a molecular weight of 449.41 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methylsulfanyl]-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-[(3,4-dichlorophenyl)methylsulfanyl]-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 6210254 |
| Molecular Formula | C20H22Cl2N6S |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methylsulfanyl]-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-1H-1,2,4-triazol-5-amine |
| SMILES | CCN(CC)c1ccc(/C=N\Nc2nc(SCc3ccc(Cl)c(Cl)c3)n[nH]2)cc1 |
| InChI | InChI=1S/C20H22Cl2N6S/c1-3-28(4-2)16-8-5-14(6-9-16)12-23-25-19-24-20(27-26-19)29-13-15-7-10-17(21)18(22)11-15/h5-12H,3-4,13H2,1-2H3,(H2,24,25,26,27)/b23-12- |
| InChIKey | ZSKKKOYTDVEDHU-FMCGGJTJSA-N |
| XLogP | 5.70 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|