C24H28N8OS2 — CID 29092994
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 29092994) has the molecular formula C24H28N8OS2 and a molecular weight of 508.68 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 29092994 |
| Molecular Formula | C24H28N8OS2 |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCN(CC)c1ccc(/C=N\Nc2nc(SCC(=O)Nc3sc4c(c3C#N)CCCC4)n[nH]2)cc1 |
| InChI | InChI=1S/C24H28N8OS2/c1-3-32(4-2)17-11-9-16(10-12-17)14-26-29-23-28-24(31-30-23)34-15-21(33)27-22-19(13-25)18-7-5-6-8-20(18)35-22/h9-12,14H,3-8,15H2,1-2H3,(H,27,33)(H2,28,29,30,31)/b26-14- |
| InChIKey | MMLOMJXYZUTRFZ-WGARJPEWSA-N |
| XLogP | 4.64 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|