C20H21BrN6O2S — CID 28701394
N-(4-bromo-2-methylphenyl)-2-[[5-[(2Z)-2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 28701394) has the molecular formula C20H21BrN6O2S and a molecular weight of 489.40 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-2-[[5-[(2Z)-2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-2-[[5-[(2Z)-2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 28701394 |
| Molecular Formula | C20H21BrN6O2S |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2-[[5-[(2Z)-2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCOc1ccc(/C=N\Nc2nc(SCC(=O)Nc3ccc(Br)cc3C)n[nH]2)cc1 |
| InChI | InChI=1S/C20H21BrN6O2S/c1-3-29-16-7-4-14(5-8-16)11-22-25-19-24-20(27-26-19)30-12-18(28)23-17-9-6-15(21)10-13(17)2/h4-11H,3,12H2,1-2H3,(H,23,28)(H2,24,25,26,27)/b22-11- |
| InChIKey | ZNVXYIOYYRGYOI-JJFYIABZSA-N |
| XLogP | 4.45 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|