C16H16BrN7OS — CID 28873311
2-[[5-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-1-(3,5-dimethylpyrazol-1-yl)ethanone (PubChem CID 28873311) has the molecular formula C16H16BrN7OS and a molecular weight of 434.32 g/mol. Its IUPAC name is 2-[[5-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-1-(3,5-dimethylpyrazol-1-yl)ethanone.
| Compound Name | 2-[[5-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-1-(3,5-dimethylpyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 28873311 |
| Molecular Formula | C16H16BrN7OS |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | 2-[[5-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-1-(3,5-dimethylpyrazol-1-yl)ethanone |
| SMILES | Cc1cc(C)n(C(=O)CSc2n[nH]c(N/N=C\c3cccc(Br)c3)n2)n1 |
| InChI | InChI=1S/C16H16BrN7OS/c1-10-6-11(2)24(23-10)14(25)9-26-16-19-15(21-22-16)20-18-8-12-4-3-5-13(17)7-12/h3-8H,9H2,1-2H3,(H2,19,20,21,22)/b18-8- |
| InChIKey | XJNFOTXOJLDIMS-LSCVHKIXSA-N |
| XLogP | 3.26 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|