C23H21N5OS — CID 7939405
3-[(2-methylphenyl)methylsulfanyl]-N-[(Z)-(3-phenoxyphenyl)methylideneamino]-1H-1,2,4-triazol-5-amine (PubChem CID 7939405) has the molecular formula C23H21N5OS and a molecular weight of 415.52 g/mol. Its IUPAC name is 3-[(2-methylphenyl)methylsulfanyl]-N-[(Z)-(3-phenoxyphenyl)methylideneamino]-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-[(2-methylphenyl)methylsulfanyl]-N-[(Z)-(3-phenoxyphenyl)methylideneamino]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 7939405 |
| Molecular Formula | C23H21N5OS |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 3-[(2-methylphenyl)methylsulfanyl]-N-[(Z)-(3-phenoxyphenyl)methylideneamino]-1H-1,2,4-triazol-5-amine |
| SMILES | Cc1ccccc1CSc1n[nH]c(N/N=C\c2cccc(Oc3ccccc3)c2)n1 |
| InChI | InChI=1S/C23H21N5OS/c1-17-8-5-6-10-19(17)16-30-23-25-22(27-28-23)26-24-15-18-9-7-13-21(14-18)29-20-11-3-2-4-12-20/h2-15H,16H2,1H3,(H2,25,26,27,28)/b24-15- |
| InChIKey | PANXZUJLQXXAOV-IWIPYMOSSA-N |
| XLogP | 5.64 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|