C21H13N3O2S — CID 2311133
[[1,3-benzothiazol-2-yl(cyano)methylidene]amino] 2-naphthalen-1-ylacetate (PubChem CID 2311133) has the molecular formula C21H13N3O2S and a molecular weight of 371.42 g/mol. Its IUPAC name is [[1,3-benzothiazol-2-yl(cyano)methylidene]amino] 2-naphthalen-1-ylacetate.
| Compound Name | [[1,3-benzothiazol-2-yl(cyano)methylidene]amino] 2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 2311133 |
| Molecular Formula | C21H13N3O2S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | [[1,3-benzothiazol-2-yl(cyano)methylidene]amino] 2-naphthalen-1-ylacetate |
| SMILES | N#CC(=NOC(=O)Cc1cccc2ccccc12)c1nc2ccccc2s1 |
| InChI | InChI=1S/C21H13N3O2S/c22-13-18(21-23-17-10-3-4-11-19(17)27-21)24-26-20(25)12-15-8-5-7-14-6-1-2-9-16(14)15/h1-11H,12H2 |
| InChIKey | GGSHTAZOPJPRPM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 75.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|