C17H12Cl2N6O2S — CID 135698753
(2E)-2-[5-[(2-chlorophenyl)diazenyl]-4-hydroxy-1,3-thiazol-2-yl]-2-[(2-chlorophenyl)hydrazinylidene]acetamide (PubChem CID 135698753) has the molecular formula C17H12Cl2N6O2S and a molecular weight of 435.30 g/mol. Its IUPAC name is (2E)-2-[5-[(2-chlorophenyl)diazenyl]-4-hydroxy-1,3-thiazol-2-yl]-2-[(2-chlorophenyl)hydrazinylidene]acetamide.
| Compound Name | (2E)-2-[5-[(2-chlorophenyl)diazenyl]-4-hydroxy-1,3-thiazol-2-yl]-2-[(2-chlorophenyl)hydrazinylidene]acetamide |
|---|---|
| PubChem CID | 135698753 |
| Molecular Formula | C17H12Cl2N6O2S |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | (2E)-2-[5-[(2-chlorophenyl)diazenyl]-4-hydroxy-1,3-thiazol-2-yl]-2-[(2-chlorophenyl)hydrazinylidene]acetamide |
| SMILES | NC(=O)/C(=N\Nc1ccccc1Cl)c1nc(O)c(/N=N/c2ccccc2Cl)s1 |
| InChI | InChI=1S/C17H12Cl2N6O2S/c18-9-5-1-3-7-11(9)22-24-13(14(20)26)16-21-15(27)17(28-16)25-23-12-8-4-2-6-10(12)19/h1-8,22,27H,(H2,20,26)/b24-13+,25-23+ |
| InChIKey | OQBSZRHYKLZBJS-OBYGDSCDSA-N |
| XLogP | 4.87 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|