C15H10ClN5 — CID 3576719
N-(2-chloroanilino)-1H-benzimidazole-2-carboximidoyl cyanide (PubChem CID 3576719) has the molecular formula C15H10ClN5 and a molecular weight of 295.73 g/mol. Its IUPAC name is N-(2-chloroanilino)-1H-benzimidazole-2-carboximidoyl cyanide.
| Compound Name | N-(2-chloroanilino)-1H-benzimidazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 3576719 |
| Molecular Formula | C15H10ClN5 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | N-(2-chloroanilino)-1H-benzimidazole-2-carboximidoyl cyanide |
| SMILES | N#CC(=NNc1ccccc1Cl)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H10ClN5/c16-10-5-1-2-6-11(10)20-21-14(9-17)15-18-12-7-3-4-8-13(12)19-15/h1-8,20H,(H,18,19) |
| InChIKey | SUQGQMDWYBCJAP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|