C15H10FN5 — CID 135851014
(2E)-N-(2-fluoroanilino)-1H-benzimidazole-2-carboximidoyl cyanide (PubChem CID 135851014) has the molecular formula C15H10FN5 and a molecular weight of 279.28 g/mol. Its IUPAC name is (2E)-N-(2-fluoroanilino)-1H-benzimidazole-2-carboximidoyl cyanide.
| Compound Name | (2E)-N-(2-fluoroanilino)-1H-benzimidazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 135851014 |
| Molecular Formula | C15H10FN5 |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | (2E)-N-(2-fluoroanilino)-1H-benzimidazole-2-carboximidoyl cyanide |
| SMILES | N#C/C(=N\Nc1ccccc1F)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H10FN5/c16-10-5-1-2-6-11(10)20-21-14(9-17)15-18-12-7-3-4-8-13(12)19-15/h1-8,20H,(H,18,19)/b21-14+ |
| InChIKey | BJDISODLKZTAED-KGENOOAVSA-N |
| XLogP | 3.04 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|