C17H13N5O2 — CID 135445811
N-(2-methoxyanilino)-4-oxo-3H-quinazoline-2-carboximidoyl cyanide (PubChem CID 135445811) has the molecular formula C17H13N5O2 and a molecular weight of 319.32 g/mol. Its IUPAC name is N-(2-methoxyanilino)-4-oxo-3H-quinazoline-2-carboximidoyl cyanide.
| Compound Name | N-(2-methoxyanilino)-4-oxo-3H-quinazoline-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 135445811 |
| Molecular Formula | C17H13N5O2 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N-(2-methoxyanilino)-4-oxo-3H-quinazoline-2-carboximidoyl cyanide |
| SMILES | COc1ccccc1NN=C(C#N)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H13N5O2/c1-24-15-9-5-4-8-13(15)21-22-14(10-18)16-19-12-7-3-2-6-11(12)17(23)20-16/h2-9,21H,1H3,(H,19,20,23) |
| InChIKey | AIPFLPSRWUYXAN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|