C16H11N5O2 — CID 135527903
N-(3-hydroxyanilino)-4-oxo-3H-quinazoline-2-carboximidoyl cyanide (PubChem CID 135527903) has the molecular formula C16H11N5O2 and a molecular weight of 305.30 g/mol. Its IUPAC name is N-(3-hydroxyanilino)-4-oxo-3H-quinazoline-2-carboximidoyl cyanide.
| Compound Name | N-(3-hydroxyanilino)-4-oxo-3H-quinazoline-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 135527903 |
| Molecular Formula | C16H11N5O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | N-(3-hydroxyanilino)-4-oxo-3H-quinazoline-2-carboximidoyl cyanide |
| SMILES | N#CC(=NNc1cccc(O)c1)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C16H11N5O2/c17-9-14(21-20-10-4-3-5-11(22)8-10)15-18-13-7-2-1-6-12(13)16(23)19-15/h1-8,20,22H,(H,18,19,23) |
| InChIKey | IOAMFZGUZGRFHK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 114.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|