C13H7N7 — CID 137304177
(2E)-N-anilino-4,5-dicyano-1H-imidazole-2-carboximidoyl cyanide (PubChem CID 137304177) has the molecular formula C13H7N7 and a molecular weight of 261.25 g/mol. Its IUPAC name is (2E)-N-anilino-4,5-dicyano-1H-imidazole-2-carboximidoyl cyanide.
| Compound Name | (2E)-N-anilino-4,5-dicyano-1H-imidazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 137304177 |
| Molecular Formula | C13H7N7 |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | (2E)-N-anilino-4,5-dicyano-1H-imidazole-2-carboximidoyl cyanide |
| SMILES | N#C/C(=N\Nc1ccccc1)c1nc(C#N)c(C#N)[nH]1 |
| InChI | InChI=1S/C13H7N7/c14-6-10-11(7-15)18-13(17-10)12(8-16)20-19-9-4-2-1-3-5-9/h1-5,19H,(H,17,18)/b20-12+ |
| InChIKey | RMTQMIKVFXADNL-UDWIEESQSA-N |
| XLogP | 1.49 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|