C18H15N5O2 — CID 135555016
ethyl 4-[(2Z)-2-[1H-benzimidazol-2-yl(cyano)methylidene]hydrazinyl]benzoate (PubChem CID 135555016) has the molecular formula C18H15N5O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is ethyl 4-[(2Z)-2-[1H-benzimidazol-2-yl(cyano)methylidene]hydrazinyl]benzoate.
| Compound Name | ethyl 4-[(2Z)-2-[1H-benzimidazol-2-yl(cyano)methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 135555016 |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | ethyl 4-[(2Z)-2-[1H-benzimidazol-2-yl(cyano)methylidene]hydrazinyl]benzoate |
| SMILES | CCOC(=O)c1ccc(N/N=C(/C#N)c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C18H15N5O2/c1-2-25-18(24)12-7-9-13(10-8-12)22-23-16(11-19)17-20-14-5-3-4-6-15(14)21-17/h3-10,22H,2H2,1H3,(H,20,21)/b23-16- |
| InChIKey | WXJJXYRDSVQPLM-KQWNVCNZSA-N |
| XLogP | 3.08 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|