C17H14N8 — CID 139226688
(2E)-N-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)amino]-1H-benzimidazole-2-carboximidoyl cyanide (PubChem CID 139226688) has the molecular formula C17H14N8 and a molecular weight of 330.36 g/mol. Its IUPAC name is (2E)-N-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)amino]-1H-benzimidazole-2-carboximidoyl cyanide.
| Compound Name | (2E)-N-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)amino]-1H-benzimidazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 139226688 |
| Molecular Formula | C17H14N8 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (2E)-N-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)amino]-1H-benzimidazole-2-carboximidoyl cyanide |
| SMILES | Cc1cc(C)c2c(N/N=C(\C#N)c3nc4ccccc4[nH]3)[nH]nc2n1 |
| InChI | InChI=1S/C17H14N8/c1-9-7-10(2)19-16-14(9)17(25-23-16)24-22-13(8-18)15-20-11-5-3-4-6-12(11)21-15/h3-7H,1-2H3,(H,20,21)(H2,19,23,24,25)/b22-13+ |
| InChIKey | SHVYWDMCNLOVIJ-LPYMAVHISA-N |
| XLogP | 2.79 |
| TPSA | 118.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|