C17H13ClN4 — CID 5224748
2-(1H-benzimidazol-2-yl)-3-(3-chloro-4-methylanilino)prop-2-enenitrile (PubChem CID 5224748) has the molecular formula C17H13ClN4 and a molecular weight of 308.77 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-(3-chloro-4-methylanilino)prop-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-(3-chloro-4-methylanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 5224748 |
| Molecular Formula | C17H13ClN4 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-(3-chloro-4-methylanilino)prop-2-enenitrile |
| SMILES | Cc1ccc(NC=C(C#N)c2nc3ccccc3[nH]2)cc1Cl |
| InChI | InChI=1S/C17H13ClN4/c1-11-6-7-13(8-14(11)18)20-10-12(9-19)17-21-15-4-2-3-5-16(15)22-17/h2-8,10,20H,1H3,(H,21,22) |
| InChIKey | UMEQYLMGWKIOSF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|