C22H16Cl2N4 — CID 124650445
(Z)-2-(1H-benzimidazol-2-yl)-3-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile (PubChem CID 124650445) has the molecular formula C22H16Cl2N4 and a molecular weight of 407.30 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-3-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-3-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 124650445 |
| Molecular Formula | C22H16Cl2N4 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-3-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(/C#N)c2nc3ccccc3[nH]2)c(C)n1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H16Cl2N4/c1-13-9-15(14(2)28(13)17-7-8-18(23)19(24)11-17)10-16(12-25)22-26-20-5-3-4-6-21(20)27-22/h3-11H,1-2H3,(H,26,27)/b16-10- |
| InChIKey | BVJSJUPNVVODPW-YBEGLDIGSA-N |
| XLogP | 6.34 |
| TPSA | 57.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|