C23H16ClF3N4 — CID 56777683
(Z)-2-(1H-benzimidazol-2-yl)-3-[1-[2-chloro-5-(trifluoromethyl)phenyl]-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile (PubChem CID 56777683) has the molecular formula C23H16ClF3N4 and a molecular weight of 440.86 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-3-[1-[2-chloro-5-(trifluoromethyl)phenyl]-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-3-[1-[2-chloro-5-(trifluoromethyl)phenyl]-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 56777683 |
| Molecular Formula | C23H16ClF3N4 |
| Molecular Weight | 440.86 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-3-[1-[2-chloro-5-(trifluoromethyl)phenyl]-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(/C#N)c2nc3ccccc3[nH]2)c(C)n1-c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C23H16ClF3N4/c1-13-9-15(10-16(12-28)22-29-19-5-3-4-6-20(19)30-22)14(2)31(13)21-11-17(23(25,26)27)7-8-18(21)24/h3-11H,1-2H3,(H,29,30)/b16-10- |
| InChIKey | JWHVCFGAARHGCT-YBEGLDIGSA-N |
| XLogP | 6.71 |
| TPSA | 57.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.86 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|