C24H19N5 — CID 3901270
4-[3-[2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-2,5-dimethylpyrrol-1-yl]benzonitrile (PubChem CID 3901270) has the molecular formula C24H19N5 and a molecular weight of 377.45 g/mol. Its IUPAC name is 4-[3-[2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-2,5-dimethylpyrrol-1-yl]benzonitrile.
| Compound Name | 4-[3-[2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-2,5-dimethylpyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 3901270 |
| Molecular Formula | C24H19N5 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 4-[3-[2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-2,5-dimethylpyrrol-1-yl]benzonitrile |
| SMILES | Cc1ccc2nc(C(C#N)=Cc3cc(C)n(-c4ccc(C#N)cc4)c3C)[nH]c2c1 |
| InChI | InChI=1S/C24H19N5/c1-15-4-9-22-23(10-15)28-24(27-22)20(14-26)12-19-11-16(2)29(17(19)3)21-7-5-18(13-25)6-8-21/h4-12H,1-3H3,(H,27,28) |
| InChIKey | FXPXVDVNGWNMOU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|