C24H21BrN4 — CID 3994579
3-[1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 3994579) has the molecular formula C24H21BrN4 and a molecular weight of 445.36 g/mol. Its IUPAC name is 3-[1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-[1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3994579 |
| Molecular Formula | C24H21BrN4 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 3-[1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1ccc2nc(C(C#N)=Cc3cc(C)n(-c4ccc(Br)c(C)c4)c3C)[nH]c2c1 |
| InChI | InChI=1S/C24H21BrN4/c1-14-5-8-22-23(9-14)28-24(27-22)19(13-26)12-18-11-16(3)29(17(18)4)20-6-7-21(25)15(2)10-20/h5-12H,1-4H3,(H,27,28) |
| InChIKey | WUQQPKUUDJKKFV-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 57.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|