C22H18BrClN2 — CID 3447142
3-[1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-(2-chlorophenyl)prop-2-enenitrile (PubChem CID 3447142) has the molecular formula C22H18BrClN2 and a molecular weight of 425.76 g/mol. Its IUPAC name is 3-[1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-(2-chlorophenyl)prop-2-enenitrile.
| Compound Name | 3-[1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-(2-chlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3447142 |
| Molecular Formula | C22H18BrClN2 |
| Molecular Weight | 425.76 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | 3-[1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-(2-chlorophenyl)prop-2-enenitrile |
| SMILES | Cc1cc(-n2c(C)cc(C=C(C#N)c3ccccc3Cl)c2C)ccc1Br |
| InChI | InChI=1S/C22H18BrClN2/c1-14-10-19(8-9-21(14)23)26-15(2)11-17(16(26)3)12-18(13-25)20-6-4-5-7-22(20)24/h4-12H,1-3H3 |
| InChIKey | CQOTTWDMBVQTBS-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.76 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|