C22H19ClN2 — CID 3936351
3-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-(2-chlorophenyl)prop-2-enenitrile (PubChem CID 3936351) has the molecular formula C22H19ClN2 and a molecular weight of 346.86 g/mol. Its IUPAC name is 3-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-(2-chlorophenyl)prop-2-enenitrile.
| Compound Name | 3-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-(2-chlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3936351 |
| Molecular Formula | C22H19ClN2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 3-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-(2-chlorophenyl)prop-2-enenitrile |
| SMILES | Cc1cc(C=C(C#N)c2ccccc2Cl)c(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C22H19ClN2/c1-16-12-19(13-20(14-24)21-10-6-7-11-22(21)23)17(2)25(16)15-18-8-4-3-5-9-18/h3-13H,15H2,1-2H3 |
| InChIKey | BQKDWUAEVSTPLR-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|