C25H24N4 — CID 4666470
3-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 4666470) has the molecular formula C25H24N4 and a molecular weight of 380.50 g/mol. Its IUPAC name is 3-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4666470 |
| Molecular Formula | C25H24N4 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 3-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1cc(C)cc(-n2c(C)cc(C=C(C#N)c3nc4ccc(C)cc4[nH]3)c2C)c1 |
| InChI | InChI=1S/C25H24N4/c1-15-6-7-23-24(11-15)28-25(27-23)21(14-26)13-20-12-18(4)29(19(20)5)22-9-16(2)8-17(3)10-22/h6-13H,1-5H3,(H,27,28) |
| InChIKey | BPDRVSNJVMXTGX-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 57.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|