C22H19N5O — CID 2973020
3-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 2973020) has the molecular formula C22H19N5O and a molecular weight of 369.43 g/mol. Its IUPAC name is 3-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2973020 |
| Molecular Formula | C22H19N5O |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 3-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | COc1ccc2nc(C(C#N)=Cc3cc(C)n(-c4ccccn4)c3C)[nH]c2c1 |
| InChI | InChI=1S/C22H19N5O/c1-14-10-16(15(2)27(14)21-6-4-5-9-24-21)11-17(13-23)22-25-19-8-7-18(28-3)12-20(19)26-22/h4-12H,1-3H3,(H,25,26) |
| InChIKey | LFNFYCYTCJTGGG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|