C23H17F3N4 — CID 6147066
(E)-2-(1H-benzimidazol-2-yl)-3-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]prop-2-enenitrile (PubChem CID 6147066) has the molecular formula C23H17F3N4 and a molecular weight of 406.41 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6147066 |
| Molecular Formula | C23H17F3N4 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(\C#N)c2nc3ccccc3[nH]2)c(C)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H17F3N4/c1-14-10-16(11-17(13-27)22-28-20-8-3-4-9-21(20)29-22)15(2)30(14)19-7-5-6-18(12-19)23(24,25)26/h3-12H,1-2H3,(H,28,29)/b17-11+ |
| InChIKey | FCXGOCLPOSUQJM-GZTJUZNOSA-N |
| XLogP | 6.05 |
| TPSA | 57.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|