C23H17N4O2- — CID 7317266
2-[3-[(Z)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 7317266) has the molecular formula C23H17N4O2- and a molecular weight of 381.42 g/mol. Its IUPAC name is 2-[3-[(Z)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | 2-[3-[(Z)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 7317266 |
| Molecular Formula | C23H17N4O2- |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-[3-[(Z)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | Cc1cc(/C=C(/C#N)c2nc3ccccc3[nH]2)c(C)n1-c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C23H18N4O2/c1-14-11-16(15(2)27(14)21-10-6-3-7-18(21)23(28)29)12-17(13-24)22-25-19-8-4-5-9-20(19)26-22/h3-12H,1-2H3,(H,25,26)(H,28,29)/p-1/b17-12- |
| InChIKey | DRRLXWOFTBQDAV-ATVHPVEESA-M |
| XLogP | 3.40 |
| TPSA | 97.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|