C25H20N6O — CID 4576005
2-(1H-benzimidazol-2-yl)-3-[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]prop-2-enenitrile (PubChem CID 4576005) has the molecular formula C25H20N6O and a molecular weight of 420.48 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]prop-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4576005 |
| Molecular Formula | C25H20N6O |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]prop-2-enenitrile |
| SMILES | Cc1cc(C=C(C#N)c2nc3ccccc3[nH]2)c(C)n1-n1c(C)nc2ccccc2c1=O |
| InChI | InChI=1S/C25H20N6O/c1-15-12-18(13-19(14-26)24-28-22-10-6-7-11-23(22)29-24)16(2)30(15)31-17(3)27-21-9-5-4-8-20(21)25(31)32/h4-13H,1-3H3,(H,28,29) |
| InChIKey | PAOKNJTXQLNEFU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|