C24H19ClN4O — CID 3909191
2-(3-chlorophenyl)-3-[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]prop-2-enenitrile (PubChem CID 3909191) has the molecular formula C24H19ClN4O and a molecular weight of 414.90 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-3-[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]prop-2-enenitrile.
| Compound Name | 2-(3-chlorophenyl)-3-[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3909191 |
| Molecular Formula | C24H19ClN4O |
| Molecular Weight | 414.90 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-(3-chlorophenyl)-3-[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]prop-2-enenitrile |
| SMILES | Cc1cc(C=C(C#N)c2cccc(Cl)c2)c(C)n1-n1c(C)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H19ClN4O/c1-15-11-19(12-20(14-26)18-7-6-8-21(25)13-18)16(2)28(15)29-17(3)27-23-10-5-4-9-22(23)24(29)30/h4-13H,1-3H3 |
| InChIKey | JWDMSYRTJZJLSB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 63.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.90 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|