C26H22FN5O3 — CID 4276103
5-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 4276103) has the molecular formula C26H22FN5O3 and a molecular weight of 471.49 g/mol. Its IUPAC name is 5-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 4276103 |
| Molecular Formula | C26H22FN5O3 |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 5-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1cc(C=C2NC(=O)N(Cc3ccc(F)cc3)C2=O)c(C)n1-n1c(C)nc2ccccc2c1=O |
| InChI | InChI=1S/C26H22FN5O3/c1-15-12-19(13-23-25(34)30(26(35)29-23)14-18-8-10-20(27)11-9-18)16(2)31(15)32-17(3)28-22-7-5-4-6-21(22)24(32)33/h4-13H,14H2,1-3H3,(H,29,35) |
| InChIKey | SZGMPFCOERXOGY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|