C28H26N6O5 — CID 4555462
2-[4-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 4555462) has the molecular formula C28H26N6O5 and a molecular weight of 526.55 g/mol. Its IUPAC name is 2-[4-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[4-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 4555462 |
| Molecular Formula | C28H26N6O5 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | 2-[4-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN2C(=O)NC(=Cc3cc(C)n(-n4c(C)nc5ccccc5c4=O)c3C)C2=O)cc1 |
| InChI | InChI=1S/C28H26N6O5/c1-16-13-19(17(2)33(16)34-18(3)29-23-8-6-5-7-22(23)26(34)36)14-24-27(37)32(28(38)31-24)15-25(35)30-20-9-11-21(39-4)12-10-20/h5-14H,15H2,1-4H3,(H,30,35)(H,31,38) |
| InChIKey | ZFTPCJRNWRDCRR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 127.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|