C28H25N5O6 — CID 4038019
1-(2,4-dimethoxyphenyl)-5-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 4038019) has the molecular formula C28H25N5O6 and a molecular weight of 527.54 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-5-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(2,4-dimethoxyphenyl)-5-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 4038019 |
| Molecular Formula | C28H25N5O6 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-5-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(N2C(=O)NC(=O)C(=Cc3cc(C)n(-n4c(C)nc5ccccc5c4=O)c3C)C2=O)c(OC)c1 |
| InChI | InChI=1S/C28H25N5O6/c1-15-12-18(16(2)32(15)33-17(3)29-22-9-7-6-8-20(22)27(33)36)13-21-25(34)30-28(37)31(26(21)35)23-11-10-19(38-4)14-24(23)39-5/h6-14H,1-5H3,(H,30,34,37) |
| InChIKey | FWCHMIVROHDUBJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|