C28H25N5O3S — CID 4590171
5-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 4590171) has the molecular formula C28H25N5O3S and a molecular weight of 511.61 g/mol. Its IUPAC name is 5-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 4590171 |
| Molecular Formula | C28H25N5O3S |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 5-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCc1ccc(N2C(=O)C(=Cc3cc(C)n(-n4c(C)nc5ccccc5c4=O)c3C)C(=O)NC2=S)cc1 |
| InChI | InChI=1S/C28H25N5O3S/c1-5-19-10-12-21(13-11-19)31-26(35)23(25(34)30-28(31)37)15-20-14-16(2)32(17(20)3)33-18(4)29-24-9-7-6-8-22(24)27(33)36/h6-15H,5H2,1-4H3,(H,30,34,37) |
| InChIKey | DHMVXYAVJCCPSG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|