C24H23N5O3 — CID 4618607
N-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylideneamino]-4-methoxybenzamide (PubChem CID 4618607) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is N-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylideneamino]-4-methoxybenzamide.
| Compound Name | N-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylideneamino]-4-methoxybenzamide |
|---|---|
| PubChem CID | 4618607 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | N-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylideneamino]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NN=Cc2cc(C)n(-n3c(C)nc4ccccc4c3=O)c2C)cc1 |
| InChI | InChI=1S/C24H23N5O3/c1-15-13-19(14-25-27-23(30)18-9-11-20(32-4)12-10-18)16(2)28(15)29-17(3)26-22-8-6-5-7-21(22)24(29)31/h5-14H,1-4H3,(H,27,30) |
| InChIKey | XUZNWBKXLRRRFS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|