C26H22N6O6 — CID 3895433
N-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylideneamino]-7-methoxy-5-nitro-1-benzofuran-2-carboxamide (PubChem CID 3895433) has the molecular formula C26H22N6O6 and a molecular weight of 514.50 g/mol. Its IUPAC name is N-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylideneamino]-7-methoxy-5-nitro-1-benzofuran-2-carboxamide.
| Compound Name | N-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylideneamino]-7-methoxy-5-nitro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 3895433 |
| Molecular Formula | C26H22N6O6 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | N-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylideneamino]-7-methoxy-5-nitro-1-benzofuran-2-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])cc2cc(C(=O)NN=Cc3cc(C)n(-n4c(C)nc5ccccc5c4=O)c3C)oc12 |
| InChI | InChI=1S/C26H22N6O6/c1-14-9-18(15(2)30(14)31-16(3)28-21-8-6-5-7-20(21)26(31)34)13-27-29-25(33)23-11-17-10-19(32(35)36)12-22(37-4)24(17)38-23/h5-13H,1-4H3,(H,29,33) |
| InChIKey | WIXOXMZSRLVPTH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|