C23H16ClN3O5S — CID 126101698
N-[(Z)-[4-(4-chlorophenyl)sulfanylphenyl]methylideneamino]-7-methoxy-5-nitro-1-benzofuran-2-carboxamide (PubChem CID 126101698) has the molecular formula C23H16ClN3O5S and a molecular weight of 481.92 g/mol. Its IUPAC name is N-[(Z)-[4-(4-chlorophenyl)sulfanylphenyl]methylideneamino]-7-methoxy-5-nitro-1-benzofuran-2-carboxamide.
| Compound Name | N-[(Z)-[4-(4-chlorophenyl)sulfanylphenyl]methylideneamino]-7-methoxy-5-nitro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126101698 |
| Molecular Formula | C23H16ClN3O5S |
| Molecular Weight | 481.92 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | N-[(Z)-[4-(4-chlorophenyl)sulfanylphenyl]methylideneamino]-7-methoxy-5-nitro-1-benzofuran-2-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])cc2cc(C(=O)N/N=C\c3ccc(Sc4ccc(Cl)cc4)cc3)oc12 |
| InChI | InChI=1S/C23H16ClN3O5S/c1-31-20-12-17(27(29)30)10-15-11-21(32-22(15)20)23(28)26-25-13-14-2-6-18(7-3-14)33-19-8-4-16(24)5-9-19/h2-13H,1H3,(H,26,28)/b25-13- |
| InChIKey | CBRPBSITHAIBQI-MXAYSNPKSA-N |
| XLogP | 5.92 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.92 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|