C22H14N4O6 — CID 126024214
N-[(Z)-[5-(4-cyanophenyl)furan-2-yl]methylideneamino]-7-methoxy-5-nitro-1-benzofuran-2-carboxamide (PubChem CID 126024214) has the molecular formula C22H14N4O6 and a molecular weight of 430.38 g/mol. Its IUPAC name is N-[(Z)-[5-(4-cyanophenyl)furan-2-yl]methylideneamino]-7-methoxy-5-nitro-1-benzofuran-2-carboxamide.
| Compound Name | N-[(Z)-[5-(4-cyanophenyl)furan-2-yl]methylideneamino]-7-methoxy-5-nitro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126024214 |
| Molecular Formula | C22H14N4O6 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | N-[(Z)-[5-(4-cyanophenyl)furan-2-yl]methylideneamino]-7-methoxy-5-nitro-1-benzofuran-2-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])cc2cc(C(=O)N/N=C\c3ccc(-c4ccc(C#N)cc4)o3)oc12 |
| InChI | InChI=1S/C22H14N4O6/c1-30-19-10-16(26(28)29)8-15-9-20(32-21(15)19)22(27)25-24-12-17-6-7-18(31-17)14-4-2-13(11-23)3-5-14/h2-10,12H,1H3,(H,25,27)/b24-12- |
| InChIKey | NFZZDSZVRQECIT-MSXFZWOLSA-N |
| XLogP | 4.25 |
| TPSA | 143.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|