C19H15N5O5 — CID 168558389
1-(2-hydroxyethyl)-3-[4-(6-nitro-1H-benzimidazol-2-yl)anilino]pyrrole-2,5-dione (PubChem CID 168558389) has the molecular formula C19H15N5O5 and a molecular weight of 393.36 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[4-(6-nitro-1H-benzimidazol-2-yl)anilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[4-(6-nitro-1H-benzimidazol-2-yl)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168558389 |
| Molecular Formula | C19H15N5O5 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[4-(6-nitro-1H-benzimidazol-2-yl)anilino]pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2ccc(-c3nc4ccc([N+](=O)[O-])cc4[nH]3)cc2)C(=O)N1CCO |
| InChI | InChI=1S/C19H15N5O5/c25-8-7-23-17(26)10-16(19(23)27)20-12-3-1-11(2-4-12)18-21-14-6-5-13(24(28)29)9-15(14)22-18/h1-6,9-10,20,25H,7-8H2,(H,21,22) |
| InChIKey | GCDBXYAOTHLZSB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 141.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|