C12H11N3O6 — CID 168556017
1-(2-hydroxyethyl)-3-(2-hydroxy-5-nitroanilino)pyrrole-2,5-dione (PubChem CID 168556017) has the molecular formula C12H11N3O6 and a molecular weight of 293.23 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-(2-hydroxy-5-nitroanilino)pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-(2-hydroxy-5-nitroanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168556017 |
| Molecular Formula | C12H11N3O6 |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-(2-hydroxy-5-nitroanilino)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2cc([N+](=O)[O-])ccc2O)C(=O)N1CCO |
| InChI | InChI=1S/C12H11N3O6/c16-4-3-14-11(18)6-9(12(14)19)13-8-5-7(15(20)21)1-2-10(8)17/h1-2,5-6,13,16-17H,3-4H2 |
| InChIKey | OJUHYXFRTYUWSY-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 133.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|