C13H14N4O5 — CID 168559490
1-(2-hydroxyethyl)-3-[2-(methylamino)-5-nitroanilino]pyrrole-2,5-dione (PubChem CID 168559490) has the molecular formula C13H14N4O5 and a molecular weight of 306.28 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[2-(methylamino)-5-nitroanilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[2-(methylamino)-5-nitroanilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168559490 |
| Molecular Formula | C13H14N4O5 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[2-(methylamino)-5-nitroanilino]pyrrole-2,5-dione |
| SMILES | CNc1ccc([N+](=O)[O-])cc1NC1=CC(=O)N(CCO)C1=O |
| InChI | InChI=1S/C13H14N4O5/c1-14-9-3-2-8(17(21)22)6-10(9)15-11-7-12(19)16(4-5-18)13(11)20/h2-3,6-7,14-15,18H,4-5H2,1H3 |
| InChIKey | FVHKINIFEQOHBS-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 124.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|