C17H10N4O7 — CID 169327539
2-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-1,3-dioxoisoindol-2-yl]acetic acid (PubChem CID 169327539) has the molecular formula C17H10N4O7 and a molecular weight of 382.29 g/mol. Its IUPAC name is 2-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-1,3-dioxoisoindol-2-yl]acetic acid.
| Compound Name | 2-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-1,3-dioxoisoindol-2-yl]acetic acid |
|---|---|
| PubChem CID | 169327539 |
| Molecular Formula | C17H10N4O7 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 2-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-1,3-dioxoisoindol-2-yl]acetic acid |
| SMILES | Nc1c2c(cc(=O)n1-c1cccc3c1C(=O)N(CC(=O)O)C3=O)C(=O)NC2=O |
| InChI | InChI=1S/C17H10N4O7/c18-13-12-7(14(25)19-15(12)26)4-9(22)21(13)8-3-1-2-6-11(8)17(28)20(16(6)27)5-10(23)24/h1-4H,5,18H2,(H,23,24)(H,19,25,26) |
| InChIKey | IIOBFHIRXGNMDL-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 168.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|