C15H7F3N4O3 — CID 169326868
4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-(trifluoromethyl)benzonitrile (PubChem CID 169326868) has the molecular formula C15H7F3N4O3 and a molecular weight of 348.24 g/mol. Its IUPAC name is 4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 169326868 |
| Molecular Formula | C15H7F3N4O3 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(-n2c(N)c3c(cc2=O)C(=O)NC3=O)cc1C(F)(F)F |
| InChI | InChI=1S/C15H7F3N4O3/c16-15(17,18)9-3-7(2-1-6(9)5-19)22-10(23)4-8-11(12(22)20)14(25)21-13(8)24/h1-4H,20H2,(H,21,24,25) |
| InChIKey | XJLGFDYIJKSWIX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|