C15H10F3N3O4 — CID 169329595
4-amino-5-[4-(2,2,2-trifluoroethoxy)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169329595) has the molecular formula C15H10F3N3O4 and a molecular weight of 353.26 g/mol. Its IUPAC name is 4-amino-5-[4-(2,2,2-trifluoroethoxy)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[4-(2,2,2-trifluoroethoxy)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169329595 |
| Molecular Formula | C15H10F3N3O4 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 4-amino-5-[4-(2,2,2-trifluoroethoxy)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1ccc(OCC(F)(F)F)cc1)C(=O)NC2=O |
| InChI | InChI=1S/C15H10F3N3O4/c16-15(17,18)6-25-8-3-1-7(2-4-8)21-10(22)5-9-11(12(21)19)14(24)20-13(9)23/h1-5H,6,19H2,(H,20,23,24) |
| InChIKey | ZMHJYNKUGGAYKQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|