C14H8F3N3O3S — CID 169331656
4-amino-5-[3-(trifluoromethylsulfanyl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169331656) has the molecular formula C14H8F3N3O3S and a molecular weight of 355.30 g/mol. Its IUPAC name is 4-amino-5-[3-(trifluoromethylsulfanyl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[3-(trifluoromethylsulfanyl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169331656 |
| Molecular Formula | C14H8F3N3O3S |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 4-amino-5-[3-(trifluoromethylsulfanyl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1cccc(SC(F)(F)F)c1)C(=O)NC2=O |
| InChI | InChI=1S/C14H8F3N3O3S/c15-14(16,17)24-7-3-1-2-6(4-7)20-9(21)5-8-10(11(20)18)13(23)19-12(8)22/h1-5H,18H2,(H,19,22,23) |
| InChIKey | QWRFOJGKWCOUOE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|