C20H12F3N3O3S — CID 169331621
4-amino-5-[4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169331621) has the molecular formula C20H12F3N3O3S and a molecular weight of 431.40 g/mol. Its IUPAC name is 4-amino-5-[4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169331621 |
| Molecular Formula | C20H12F3N3O3S |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 4-amino-5-[4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1ccc(Sc3cccc(C(F)(F)F)c3)cc1)C(=O)NC2=O |
| InChI | InChI=1S/C20H12F3N3O3S/c21-20(22,23)10-2-1-3-13(8-10)30-12-6-4-11(5-7-12)26-15(27)9-14-16(17(26)24)19(29)25-18(14)28/h1-9H,24H2,(H,25,28,29) |
| InChIKey | XHOGPPYGHPYWSO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|