C23H18ClF3N6O3 — CID 169328057
4-amino-5-[4-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169328057) has the molecular formula C23H18ClF3N6O3 and a molecular weight of 518.88 g/mol. Its IUPAC name is 4-amino-5-[4-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[4-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169328057 |
| Molecular Formula | C23H18ClF3N6O3 |
| Molecular Weight | 518.88 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | 4-amino-5-[4-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1ccc(N3CCN(c4ncc(C(F)(F)F)cc4Cl)CC3)cc1)C(=O)NC2=O |
| InChI | InChI=1S/C23H18ClF3N6O3/c24-16-9-12(23(25,26)27)11-29-20(16)32-7-5-31(6-8-32)13-1-3-14(4-2-13)33-17(34)10-15-18(19(33)28)22(36)30-21(15)35/h1-4,9-11H,5-8,28H2,(H,30,35,36) |
| InChIKey | JHUOIYQPJAAPDK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 113.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.88 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|