C19H8F5N3O4 — CID 169328362
4-amino-5-[3-(2,3,4,5,6-pentafluorophenoxy)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169328362) has the molecular formula C19H8F5N3O4 and a molecular weight of 437.28 g/mol. Its IUPAC name is 4-amino-5-[3-(2,3,4,5,6-pentafluorophenoxy)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[3-(2,3,4,5,6-pentafluorophenoxy)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169328362 |
| Molecular Formula | C19H8F5N3O4 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 4-amino-5-[3-(2,3,4,5,6-pentafluorophenoxy)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1cccc(Oc3c(F)c(F)c(F)c(F)c3F)c1)C(=O)NC2=O |
| InChI | InChI=1S/C19H8F5N3O4/c20-11-12(21)14(23)16(15(24)13(11)22)31-7-3-1-2-6(4-7)27-9(28)5-8-10(17(27)25)19(30)26-18(8)29/h1-5H,25H2,(H,26,29,30) |
| InChIKey | LDEPTBGUJFEIET-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|