C15H9N5O4S — CID 169329372
4-amino-5-[3-(1,3,4-thiadiazol-2-yloxy)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169329372) has the molecular formula C15H9N5O4S and a molecular weight of 355.34 g/mol. Its IUPAC name is 4-amino-5-[3-(1,3,4-thiadiazol-2-yloxy)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[3-(1,3,4-thiadiazol-2-yloxy)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169329372 |
| Molecular Formula | C15H9N5O4S |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 4-amino-5-[3-(1,3,4-thiadiazol-2-yloxy)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1cccc(Oc3nncs3)c1)C(=O)NC2=O |
| InChI | InChI=1S/C15H9N5O4S/c16-12-11-9(13(22)18-14(11)23)5-10(21)20(12)7-2-1-3-8(4-7)24-15-19-17-6-25-15/h1-6H,16H2,(H,18,22,23) |
| InChIKey | AHVMIVUZHQEQMF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|