C21H13N5O3S — CID 169330271
4-amino-5-[3-(4-pyridin-3-yl-1,3-thiazol-2-yl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169330271) has the molecular formula C21H13N5O3S and a molecular weight of 415.43 g/mol. Its IUPAC name is 4-amino-5-[3-(4-pyridin-3-yl-1,3-thiazol-2-yl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[3-(4-pyridin-3-yl-1,3-thiazol-2-yl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169330271 |
| Molecular Formula | C21H13N5O3S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 4-amino-5-[3-(4-pyridin-3-yl-1,3-thiazol-2-yl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1cccc(-c3nc(-c4cccnc4)cs3)c1)C(=O)NC2=O |
| InChI | InChI=1S/C21H13N5O3S/c22-18-17-14(19(28)25-20(17)29)8-16(27)26(18)13-5-1-3-11(7-13)21-24-15(10-30-21)12-4-2-6-23-9-12/h1-10H,22H2,(H,25,28,29) |
| InChIKey | TUTIHQVZZLLVBK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|