C22H14N4O3S — CID 169330161
4-amino-5-[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169330161) has the molecular formula C22H14N4O3S and a molecular weight of 414.45 g/mol. Its IUPAC name is 4-amino-5-[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169330161 |
| Molecular Formula | C22H14N4O3S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 4-amino-5-[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1cccc(-c3nc(-c4ccccc4)cs3)c1)C(=O)NC2=O |
| InChI | InChI=1S/C22H14N4O3S/c23-19-18-15(20(28)25-21(18)29)10-17(27)26(19)14-8-4-7-13(9-14)22-24-16(11-30-22)12-5-2-1-3-6-12/h1-11H,23H2,(H,25,28,29) |
| InChIKey | AYWOHJVNQMIEHA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|