C17H9F3N4O3S — CID 169329021
4-amino-5-[3-[2-(trifluoromethyl)-1,3-thiazol-4-yl]phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169329021) has the molecular formula C17H9F3N4O3S and a molecular weight of 406.35 g/mol. Its IUPAC name is 4-amino-5-[3-[2-(trifluoromethyl)-1,3-thiazol-4-yl]phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[3-[2-(trifluoromethyl)-1,3-thiazol-4-yl]phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169329021 |
| Molecular Formula | C17H9F3N4O3S |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | 4-amino-5-[3-[2-(trifluoromethyl)-1,3-thiazol-4-yl]phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1cccc(-c3csc(C(F)(F)F)n3)c1)C(=O)NC2=O |
| InChI | InChI=1S/C17H9F3N4O3S/c18-17(19,20)16-22-10(6-28-16)7-2-1-3-8(4-7)24-11(25)5-9-12(13(24)21)15(27)23-14(9)26/h1-6H,21H2,(H,23,26,27) |
| InChIKey | IKCJDLATPQUYOD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|